![[ICO]](/icons/blank.gif){kind=icon}
![[DIR]](/icons/back.gif){kind=icon}
![[DIR]](/icons/folder.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| J Physical Security (LALP-04-023)/ | 08-Jul-2007 15:33 | - | |
| RFID and CMB vulnerabilities/ | 08-Jul-2007 15:34 | - | |
| Russian translations/ | 08-Jul-2007 15:34 | - | |
| about the VAT/ | 08-Jul-2007 15:33 | - | |
| cargo security/ | 08-Jul-2007 15:33 | - | |
| drug tampering and counterfeiting/ | 08-Jul-2007 15:33 | - | |
| install viewers (if needed)/ | 08-Jul-2007 15:33 | - | |
| newpapers/ | 08-Jul-2007 15:37 | - | |
| nuclear safeguards/ | 08-Jul-2007 15:33 | - | |
| rapid sampling tools/ | 08-Jul-2007 15:33 | - | |
| securitymaxims.ppt | 23-Sep-2008 20:00 | 738K | |
| tags and seals/ | 08-Jul-2007 15:36 | - | |
| tamper and intrusion detection/ | 08-Jul-2007 15:36 | - | |
| vulnerability assessments/ | 08-Jul-2007 15:37 | - | |